C15H15F2N5O2 — CID 133458589
4-[4-(2,6-difluoro-4-nitrophenyl)piperazin-1-yl]-2-methylpyrimidine (PubChem CID 133458589) has the molecular formula C15H15F2N5O2 and a molecular weight of 335.31 g/mol. Its IUPAC name is 4-[4-(2,6-difluoro-4-nitrophenyl)piperazin-1-yl]-2-methylpyrimidine.
| Compound Name | 4-[4-(2,6-difluoro-4-nitrophenyl)piperazin-1-yl]-2-methylpyrimidine |
|---|---|
| PubChem CID | 133458589 |
| Molecular Formula | C15H15F2N5O2 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-[4-(2,6-difluoro-4-nitrophenyl)piperazin-1-yl]-2-methylpyrimidine |
| SMILES | Cc1nccc(N2CCN(c3c(F)cc([N+](=O)[O-])cc3F)CC2)n1 |
| InChI | InChI=1S/C15H15F2N5O2/c1-10-18-3-2-14(19-10)20-4-6-21(7-5-20)15-12(16)8-11(22(23)24)9-13(15)17/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | KBIJTXODRKLEEF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|