C13H17F2N3O3 — CID 133328156
3-[4-(2,6-difluoro-4-nitrophenyl)piperazin-1-yl]propan-1-ol (PubChem CID 133328156) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is 3-[4-(2,6-difluoro-4-nitrophenyl)piperazin-1-yl]propan-1-ol.
| Compound Name | 3-[4-(2,6-difluoro-4-nitrophenyl)piperazin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 133328156 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-[4-(2,6-difluoro-4-nitrophenyl)piperazin-1-yl]propan-1-ol |
| SMILES | O=[N+]([O-])c1cc(F)c(N2CCN(CCCO)CC2)c(F)c1 |
| InChI | InChI=1S/C13H17F2N3O3/c14-11-8-10(18(20)21)9-12(15)13(11)17-5-3-16(4-6-17)2-1-7-19/h8-9,19H,1-7H2 |
| InChIKey | JSHCNTQQMKFYBH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|