C13H16F2N2O2 — CID 124560155
(3R,5R)-1-(2,6-difluoro-4-nitrophenyl)-3,5-dimethylpiperidine (PubChem CID 124560155) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is (3R,5R)-1-(2,6-difluoro-4-nitrophenyl)-3,5-dimethylpiperidine.
| Compound Name | (3R,5R)-1-(2,6-difluoro-4-nitrophenyl)-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 124560155 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (3R,5R)-1-(2,6-difluoro-4-nitrophenyl)-3,5-dimethylpiperidine |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2c(F)cc([N+](=O)[O-])cc2F)C1 |
| InChI | InChI=1S/C13H16F2N2O2/c1-8-3-9(2)7-16(6-8)13-11(14)4-10(17(18)19)5-12(13)15/h4-5,8-9H,3,6-7H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | AJOPIUDOBNTJNN-RKDXNWHRSA-N |
| XLogP | 3.36 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|