C15H19N3O6 — CID 47807821
methyl 2-(3,5-dimethylpiperidin-1-yl)-3,5-dinitrobenzoate (PubChem CID 47807821) has the molecular formula C15H19N3O6 and a molecular weight of 337.33 g/mol. Its IUPAC name is methyl 2-(3,5-dimethylpiperidin-1-yl)-3,5-dinitrobenzoate.
| Compound Name | methyl 2-(3,5-dimethylpiperidin-1-yl)-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 47807821 |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | methyl 2-(3,5-dimethylpiperidin-1-yl)-3,5-dinitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C15H19N3O6/c1-9-4-10(2)8-16(7-9)14-12(15(19)24-3)5-11(17(20)21)6-13(14)18(22)23/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | MAMSZBGKOKTDPE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|