C13H15N3O6 — CID 132593444
methyl 3,5-dinitro-2-piperidin-1-ylbenzoate (PubChem CID 132593444) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is methyl 3,5-dinitro-2-piperidin-1-ylbenzoate.
| Compound Name | methyl 3,5-dinitro-2-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 132593444 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 3,5-dinitro-2-piperidin-1-ylbenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N1CCCCC1 |
| InChI | InChI=1S/C13H15N3O6/c1-22-13(17)10-7-9(15(18)19)8-11(16(20)21)12(10)14-5-3-2-4-6-14/h7-8H,2-6H2,1H3 |
| InChIKey | JKNYDUGUHWGVRR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|