C14H17N3O6 — CID 47807853
methyl 2-(4-methylpiperidin-1-yl)-3,5-dinitrobenzoate (PubChem CID 47807853) has the molecular formula C14H17N3O6 and a molecular weight of 323.31 g/mol. Its IUPAC name is methyl 2-(4-methylpiperidin-1-yl)-3,5-dinitrobenzoate.
| Compound Name | methyl 2-(4-methylpiperidin-1-yl)-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 47807853 |
| Molecular Formula | C14H17N3O6 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | methyl 2-(4-methylpiperidin-1-yl)-3,5-dinitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N1CCC(C)CC1 |
| InChI | InChI=1S/C14H17N3O6/c1-9-3-5-15(6-4-9)13-11(14(18)23-2)7-10(16(19)20)8-12(13)17(21)22/h7-9H,3-6H2,1-2H3 |
| InChIKey | BGNCLDMXDQKBCW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|