C17H15N5O8 — CID 3656298
3,5-dinitro-2-[4-(4-nitrophenyl)piperazin-1-yl]benzoic acid (PubChem CID 3656298) has the molecular formula C17H15N5O8 and a molecular weight of 417.33 g/mol. Its IUPAC name is 3,5-dinitro-2-[4-(4-nitrophenyl)piperazin-1-yl]benzoic acid.
| Compound Name | 3,5-dinitro-2-[4-(4-nitrophenyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3656298 |
| Molecular Formula | C17H15N5O8 |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 3,5-dinitro-2-[4-(4-nitrophenyl)piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C17H15N5O8/c23-17(24)14-9-13(21(27)28)10-15(22(29)30)16(14)19-7-5-18(6-8-19)11-1-3-12(4-2-11)20(25)26/h1-4,9-10H,5-8H2,(H,23,24) |
| InChIKey | IWGHILOSIHAGFL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 173.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|