C13H15N3O6 — CID 132591550
2-(3-methylpiperidin-1-yl)-3,5-dinitrobenzoic acid (PubChem CID 132591550) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is 2-(3-methylpiperidin-1-yl)-3,5-dinitrobenzoic acid.
| Compound Name | 2-(3-methylpiperidin-1-yl)-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 132591550 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-(3-methylpiperidin-1-yl)-3,5-dinitrobenzoic acid |
| SMILES | CC1CCCN(c2c(C(=O)O)cc([N+](=O)[O-])cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H15N3O6/c1-8-3-2-4-14(7-8)12-10(13(17)18)5-9(15(19)20)6-11(12)16(21)22/h5-6,8H,2-4,7H2,1H3,(H,17,18) |
| InChIKey | DJPSQNZIEKHZHX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|