C22H22N6O7 — CID 47075128
methyl 2-[4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3,5-dinitrobenzoate (PubChem CID 47075128) has the molecular formula C22H22N6O7 and a molecular weight of 482.45 g/mol. Its IUPAC name is methyl 2-[4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3,5-dinitrobenzoate.
| Compound Name | methyl 2-[4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 47075128 |
| Molecular Formula | C22H22N6O7 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | methyl 2-[4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3,5-dinitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1N1CCN(Cc2nc(-c3ccc(C)cc3)no2)CC1 |
| InChI | InChI=1S/C22H22N6O7/c1-14-3-5-15(6-4-14)21-23-19(35-24-21)13-25-7-9-26(10-8-25)20-17(22(29)34-2)11-16(27(30)31)12-18(20)28(32)33/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | CQPBYFRGZHTLKQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 157.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|