C24H28N6O5 — CID 55500762
4-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 55500762) has the molecular formula C24H28N6O5 and a molecular weight of 480.53 g/mol. Its IUPAC name is 4-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 55500762 |
| Molecular Formula | C24H28N6O5 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 4-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | COc1ccc(-c2noc(CN3CCN(c4ccc(C(=O)NC(C)C)cc4[N+](=O)[O-])CC3)n2)cc1 |
| InChI | InChI=1S/C24H28N6O5/c1-16(2)25-24(31)18-6-9-20(21(14-18)30(32)33)29-12-10-28(11-13-29)15-22-26-23(27-35-22)17-4-7-19(34-3)8-5-17/h4-9,14,16H,10-13,15H2,1-3H3,(H,25,31) |
| InChIKey | MWYIAOUNVBPFBK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 126.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|