C22H23N5O5 — CID 55501508
1-[4-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3-nitrophenyl]ethanone (PubChem CID 55501508) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is 1-[4-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 55501508 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 1-[4-[4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-3-nitrophenyl]ethanone |
| SMILES | COc1ccc(-c2noc(CN3CCN(c4ccc(C(C)=O)cc4[N+](=O)[O-])CC3)n2)cc1 |
| InChI | InChI=1S/C22H23N5O5/c1-15(28)17-5-8-19(20(13-17)27(29)30)26-11-9-25(10-12-26)14-21-23-22(24-32-21)16-3-6-18(31-2)7-4-16/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | SPTHGSOZXUFMSH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 114.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|