C19H26N6O4 — CID 133281421
4-[4-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 133281421) has the molecular formula C19H26N6O4 and a molecular weight of 402.46 g/mol. Its IUPAC name is 4-[4-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[4-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 133281421 |
| Molecular Formula | C19H26N6O4 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 4-[4-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | Cc1noc(C(C)N2CCN(c3ccc(C(=O)NC(C)C)cc3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C19H26N6O4/c1-12(2)20-18(26)15-5-6-16(17(11-15)25(27)28)24-9-7-23(8-10-24)13(3)19-21-14(4)22-29-19/h5-6,11-13H,7-10H2,1-4H3,(H,20,26) |
| InChIKey | PMIJCMDSOLMVFO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|