C15H18ClN5O3 — CID 133281461
5-[1-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole (PubChem CID 133281461) has the molecular formula C15H18ClN5O3 and a molecular weight of 351.79 g/mol. Its IUPAC name is 5-[1-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-[1-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133281461 |
| Molecular Formula | C15H18ClN5O3 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 5-[1-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethyl]-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc(C(C)N2CCN(c3ccc([N+](=O)[O-])cc3Cl)CC2)n1 |
| InChI | InChI=1S/C15H18ClN5O3/c1-10(15-17-11(2)18-24-15)19-5-7-20(8-6-19)14-4-3-12(21(22)23)9-13(14)16/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | YBYMNMGQRXOZOW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|