C21H20N6O3S — CID 56575096
5-[1-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenyl-1,2,4-oxadiazole (PubChem CID 56575096) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 5-[1-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-[1-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 56575096 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 5-[1-[4-(6-nitro-1,3-benzothiazol-2-yl)piperazin-1-yl]ethyl]-3-phenyl-1,2,4-oxadiazole |
| SMILES | CC(c1nc(-c2ccccc2)no1)N1CCN(c2nc3ccc([N+](=O)[O-])cc3s2)CC1 |
| InChI | InChI=1S/C21H20N6O3S/c1-14(20-23-19(24-30-20)15-5-3-2-4-6-15)25-9-11-26(12-10-25)21-22-17-8-7-16(27(28)29)13-18(17)31-21/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | GRGYLRDUMDRCFO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 101.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|