C28H27N5O4 — CID 42951993
[4-[4-[1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]-3-nitrophenyl]-phenylmethanone (PubChem CID 42951993) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is [4-[4-[1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]-3-nitrophenyl]-phenylmethanone.
| Compound Name | [4-[4-[1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]-3-nitrophenyl]-phenylmethanone |
|---|---|
| PubChem CID | 42951993 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | [4-[4-[1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]-3-nitrophenyl]-phenylmethanone |
| SMILES | Cc1ccc(-c2noc(C(C)N3CCN(c4ccc(C(=O)c5ccccc5)cc4[N+](=O)[O-])CC3)n2)cc1 |
| InChI | InChI=1S/C28H27N5O4/c1-19-8-10-22(11-9-19)27-29-28(37-30-27)20(2)31-14-16-32(17-15-31)24-13-12-23(18-25(24)33(35)36)26(34)21-6-4-3-5-7-21/h3-13,18,20H,14-17H2,1-2H3 |
| InChIKey | QINGFPFCAGDSGR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 105.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|