C18H17FN4O2S — CID 573242
2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-6-nitro-1,3-benzothiazole (PubChem CID 573242) has the molecular formula C18H17FN4O2S and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-6-nitro-1,3-benzothiazole.
| Compound Name | 2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 573242 |
| Molecular Formula | C18H17FN4O2S |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-6-nitro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(N3CCN(Cc4ccccc4F)CC3)sc2c1 |
| InChI | InChI=1S/C18H17FN4O2S/c19-15-4-2-1-3-13(15)12-21-7-9-22(10-8-21)18-20-16-6-5-14(23(24)25)11-17(16)26-18/h1-6,11H,7-10,12H2 |
| InChIKey | BUBRBOAZANPHDS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|