C19H18N8O2S — CID 167443894
6-nitro-2-[4-[[2-(2H-tetrazol-5-yl)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazole (PubChem CID 167443894) has the molecular formula C19H18N8O2S and a molecular weight of 422.47 g/mol. Its IUPAC name is 6-nitro-2-[4-[[2-(2H-tetrazol-5-yl)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 6-nitro-2-[4-[[2-(2H-tetrazol-5-yl)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 167443894 |
| Molecular Formula | C19H18N8O2S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 6-nitro-2-[4-[[2-(2H-tetrazol-5-yl)phenyl]methyl]piperazin-1-yl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(N3CCN(Cc4ccccc4-c4nn[nH]n4)CC3)sc2c1 |
| InChI | InChI=1S/C19H18N8O2S/c28-27(29)14-5-6-16-17(11-14)30-19(20-16)26-9-7-25(8-10-26)12-13-3-1-2-4-15(13)18-21-23-24-22-18/h1-6,11H,7-10,12H2,(H,21,22,23,24) |
| InChIKey | JRCVSBXSFOCPMS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|