C13H15N7S — CID 167895373
2-[4-(2H-tetrazol-5-ylmethyl)piperazin-1-yl]-1,3-benzothiazole (PubChem CID 167895373) has the molecular formula C13H15N7S and a molecular weight of 301.38 g/mol. Its IUPAC name is 2-[4-(2H-tetrazol-5-ylmethyl)piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 2-[4-(2H-tetrazol-5-ylmethyl)piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 167895373 |
| Molecular Formula | C13H15N7S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[4-(2H-tetrazol-5-ylmethyl)piperazin-1-yl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(N3CCN(Cc4nn[nH]n4)CC3)nc2c1 |
| InChI | InChI=1S/C13H15N7S/c1-2-4-11-10(3-1)14-13(21-11)20-7-5-19(6-8-20)9-12-15-17-18-16-12/h1-4H,5-9H2,(H,15,16,17,18) |
| InChIKey | BBUCKOCADXIFNJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |