C18H17Cl2N3S — CID 1484927
2-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole (PubChem CID 1484927) has the molecular formula C18H17Cl2N3S and a molecular weight of 378.33 g/mol. Its IUPAC name is 2-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 2-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 1484927 |
| Molecular Formula | C18H17Cl2N3S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole |
| SMILES | Clc1ccc(CN2CCN(c3nc4ccccc4s3)CC2)cc1Cl |
| InChI | InChI=1S/C18H17Cl2N3S/c19-14-6-5-13(11-15(14)20)12-22-7-9-23(10-8-22)18-21-16-3-1-2-4-17(16)24-18/h1-6,11H,7-10,12H2 |
| InChIKey | UBGFKIBNNWUYCR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |