C17H16N4O2S — CID 71891864
2-[4-(3-nitrophenyl)piperazin-1-yl]-1,3-benzothiazole (PubChem CID 71891864) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-[4-(3-nitrophenyl)piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 2-[4-(3-nitrophenyl)piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 71891864 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-[4-(3-nitrophenyl)piperazin-1-yl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1cccc(N2CCN(c3nc4ccccc4s3)CC2)c1 |
| InChI | InChI=1S/C17H16N4O2S/c22-21(23)14-5-3-4-13(12-14)19-8-10-20(11-9-19)17-18-15-6-1-2-7-16(15)24-17/h1-7,12H,8-11H2 |
| InChIKey | LZRUCTSZYRBGEM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|