C26H22N4O4S — CID 73338536
[2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 3-(3-nitrophenyl)prop-2-enoate (PubChem CID 73338536) has the molecular formula C26H22N4O4S and a molecular weight of 486.55 g/mol. Its IUPAC name is [2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 73338536 |
| Molecular Formula | C26H22N4O4S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | [2-(4-phenylpiperazin-1-yl)-1,3-benzothiazol-6-yl] 3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)Oc1ccc2nc(N3CCN(c4ccccc4)CC3)sc2c1 |
| InChI | InChI=1S/C26H22N4O4S/c31-25(12-9-19-5-4-8-21(17-19)30(32)33)34-22-10-11-23-24(18-22)35-26(27-23)29-15-13-28(14-16-29)20-6-2-1-3-7-20/h1-12,17-18H,13-16H2 |
| InChIKey | HFITYXGKGGLPGC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|