C20H19N3O4S — CID 78737698
[2-(diethylamino)-1,3-benzothiazol-6-yl] 3-(3-nitrophenyl)prop-2-enoate (PubChem CID 78737698) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is [2-(diethylamino)-1,3-benzothiazol-6-yl] 3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-(diethylamino)-1,3-benzothiazol-6-yl] 3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 78737698 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | [2-(diethylamino)-1,3-benzothiazol-6-yl] 3-(3-nitrophenyl)prop-2-enoate |
| SMILES | CCN(CC)c1nc2ccc(OC(=O)C=Cc3cccc([N+](=O)[O-])c3)cc2s1 |
| InChI | InChI=1S/C20H19N3O4S/c1-3-22(4-2)20-21-17-10-9-16(13-18(17)28-20)27-19(24)11-8-14-6-5-7-15(12-14)23(25)26/h5-13H,3-4H2,1-2H3 |
| InChIKey | QOHZDJHUDLYGOK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|