C23H24N6O5 — CID 55682830
3-nitro-N-[2-oxo-2-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]ethyl]benzamide (PubChem CID 55682830) has the molecular formula C23H24N6O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is 3-nitro-N-[2-oxo-2-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]ethyl]benzamide.
| Compound Name | 3-nitro-N-[2-oxo-2-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 55682830 |
| Molecular Formula | C23H24N6O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 3-nitro-N-[2-oxo-2-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]ethyl]benzamide |
| SMILES | CC(c1nc(-c2ccccc2)no1)N1CCN(C(=O)CNC(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C23H24N6O5/c1-16(23-25-21(26-34-23)17-6-3-2-4-7-17)27-10-12-28(13-11-27)20(30)15-24-22(31)18-8-5-9-19(14-18)29(32)33/h2-9,14,16H,10-13,15H2,1H3,(H,24,31) |
| InChIKey | VKCGJRSFFIHXLB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|