C25H27N5O3 — CID 55682933
(E)-N-[2-oxo-2-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 55682933) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is (E)-N-[2-oxo-2-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-oxo-2-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 55682933 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (E)-N-[2-oxo-2-[4-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl]piperazin-1-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | CC(c1nc(-c2ccccc2)no1)N1CCN(C(=O)CNC(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27N5O3/c1-19(25-27-24(28-33-25)21-10-6-3-7-11-21)29-14-16-30(17-15-29)23(32)18-26-22(31)13-12-20-8-4-2-5-9-20/h2-13,19H,14-18H2,1H3,(H,26,31)/b13-12+ |
| InChIKey | UWBHXVWAUYMNPK-OUKQBFOZSA-N |
| XLogP | 2.77 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|