C20H24N8O3 — CID 133359607
4-[4-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide (PubChem CID 133359607) has the molecular formula C20H24N8O3 and a molecular weight of 424.47 g/mol. Its IUPAC name is 4-[4-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide.
| Compound Name | 4-[4-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 133359607 |
| Molecular Formula | C20H24N8O3 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 4-[4-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)piperazin-1-yl]-3-nitro-N-propan-2-ylbenzamide |
| SMILES | Cc1cc(N2CCN(c3ccc(C(=O)NC(C)C)cc3[N+](=O)[O-])CC2)n2ncnc2n1 |
| InChI | InChI=1S/C20H24N8O3/c1-13(2)23-19(29)15-4-5-16(17(11-15)28(30)31)25-6-8-26(9-7-25)18-10-14(3)24-20-21-12-22-27(18)20/h4-5,10-13H,6-9H2,1-3H3,(H,23,29) |
| InChIKey | CIIWWGWSFNZXCI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|