C13H14ClN3O6 — CID 71423414
methyl 4-chloro-3,5-dinitro-2-piperidin-1-ylbenzoate (PubChem CID 71423414) has the molecular formula C13H14ClN3O6 and a molecular weight of 343.72 g/mol. Its IUPAC name is methyl 4-chloro-3,5-dinitro-2-piperidin-1-ylbenzoate.
| Compound Name | methyl 4-chloro-3,5-dinitro-2-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 71423414 |
| Molecular Formula | C13H14ClN3O6 |
| Molecular Weight | 343.72 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | methyl 4-chloro-3,5-dinitro-2-piperidin-1-ylbenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1N1CCCCC1 |
| InChI | InChI=1S/C13H14ClN3O6/c1-23-13(18)8-7-9(16(19)20)10(14)12(17(21)22)11(8)15-5-3-2-4-6-15/h7H,2-6H2,1H3 |
| InChIKey | KPTWSEZRSZMUKF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|