C10H5ClN2O6 — CID 73426426
methyl 4-chloro-5-nitro-2,3-dioxo-1H-indole-7-carboxylate (PubChem CID 73426426) has the molecular formula C10H5ClN2O6 and a molecular weight of 284.61 g/mol. Its IUPAC name is methyl 4-chloro-5-nitro-2,3-dioxo-1H-indole-7-carboxylate.
| Compound Name | methyl 4-chloro-5-nitro-2,3-dioxo-1H-indole-7-carboxylate |
|---|---|
| PubChem CID | 73426426 |
| Molecular Formula | C10H5ClN2O6 |
| Molecular Weight | 284.61 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | methyl 4-chloro-5-nitro-2,3-dioxo-1H-indole-7-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(Cl)c2c1NC(=O)C2=O |
| InChI | InChI=1S/C10H5ClN2O6/c1-19-10(16)3-2-4(13(17)18)6(11)5-7(3)12-9(15)8(5)14/h2H,1H3,(H,12,14,15) |
| InChIKey | MZPVWUGLLPMYHO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.61 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|