About 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane
1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane (PubChem CID 91137812) has the molecular formula C12H15F2N2O3P
and a molecular weight of 304.23 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane.
Molecular Properties
| Compound Name | 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane |
| PubChem CID | 91137812 |
| Molecular Formula | C12H15F2N2O3P |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane |
| SMILES | CCOP1CCN(c2c(F)cc([N+](=O)[O-])cc2F)CC1 |
| InChI | InChI=1S/C12H15F2N2O3P/c1-2-19-20-5-3-15(4-6-20)12-10(13)7-9(16(17)18)8-11(12)14/h7-8H,2-6H2,1H3 |
| InChIKey | CAULTZRSOVTUMG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane?
The IUPAC name of 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane (CID 91137812) is 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane.
What is the SMILES notation for 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane?
The canonical SMILES for 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane is CCOP1CCN(c2c(F)cc([N+](=O)[O-])cc2F)CC1.
What is the InChIKey of 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane?
The InChIKey is CAULTZRSOVTUMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N2O3P/c1-2-19-20-5-3-15(4-6-20)12-10(13)7-9(16(17)18)8-11(12)14/h7-8H,2-6H2,1H3.
What are the key properties of 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane?
1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane has a molecular weight of 304.23 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane is sourced from PubChem (CID 91137812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).