C12H15F2N2O3P — CID 91137812
1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane (PubChem CID 91137812) has the molecular formula C12H15F2N2O3P and a molecular weight of 304.23 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane.
| Compound Name | 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane |
|---|---|
| PubChem CID | 91137812 |
| Molecular Formula | C12H15F2N2O3P |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1-(2,6-difluoro-4-nitrophenyl)-4-ethoxy-1,4-azaphosphinane |
| SMILES | CCOP1CCN(c2c(F)cc([N+](=O)[O-])cc2F)CC1 |
| InChI | InChI=1S/C12H15F2N2O3P/c1-2-19-20-5-3-15(4-6-20)12-10(13)7-9(16(17)18)8-11(12)14/h7-8H,2-6H2,1H3 |
| InChIKey | CAULTZRSOVTUMG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|