About 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole
5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole (PubChem CID 133471710) has the molecular formula C14H9BrF2N2O2
and a molecular weight of 355.14 g/mol. Its IUPAC name is 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole |
| PubChem CID | 133471710 |
| Molecular Formula | C14H9BrF2N2O2 |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole |
| SMILES | O=[N+]([O-])c1cc(F)c(N2Cc3ccc(Br)cc3C2)c(F)c1 |
| InChI | InChI=1S/C14H9BrF2N2O2/c15-10-2-1-8-6-18(7-9(8)3-10)14-12(16)4-11(19(20)21)5-13(14)17/h1-5H,6-7H2 |
| InChIKey | CPVAVTSRIHEKEH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole?
The IUPAC name of 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole (CID 133471710) is 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole.
What is the SMILES notation for 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole?
The canonical SMILES for 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole is O=[N+]([O-])c1cc(F)c(N2Cc3ccc(Br)cc3C2)c(F)c1.
What is the InChIKey of 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole?
The InChIKey is CPVAVTSRIHEKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrF2N2O2/c15-10-2-1-8-6-18(7-9(8)3-10)14-12(16)4-11(19(20)21)5-13(14)17/h1-5H,6-7H2.
What are the key properties of 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole?
5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole has a molecular weight of 355.14 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole is sourced from PubChem (CID 133471710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).