C14H9BrF2N2O2 — CID 133471710
5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole (PubChem CID 133471710) has the molecular formula C14H9BrF2N2O2 and a molecular weight of 355.14 g/mol. Its IUPAC name is 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole.
| Compound Name | 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 133471710 |
| Molecular Formula | C14H9BrF2N2O2 |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 5-bromo-2-(2,6-difluoro-4-nitrophenyl)-1,3-dihydroisoindole |
| SMILES | O=[N+]([O-])c1cc(F)c(N2Cc3ccc(Br)cc3C2)c(F)c1 |
| InChI | InChI=1S/C14H9BrF2N2O2/c15-10-2-1-8-6-18(7-9(8)3-10)14-12(16)4-11(19(20)21)5-13(14)17/h1-5H,6-7H2 |
| InChIKey | CPVAVTSRIHEKEH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|