C20H22F4N4O2S2 — CID 159810906
3,5-difluoro-4-(2,2,3,3,5,5,6,6-octadeuteriothiomorpholin-4-yl)aniline;2,2,3,3,5,5,6,6-octadeuterio-4-(2,6-difluoro-4-nitrophenyl)thiomorpholine (PubChem CID 159810906) has the molecular formula C20H22F4N4O2S2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 3,5-difluoro-4-(2,2,3,3,5,5,6,6-octadeuteriothiomorpholin-4-yl)aniline;2,2,3,3,5,5,6,6-octadeuterio-4-(2,6-difluoro-4-nitrophenyl)thiomorpholine.
| Compound Name | 3,5-difluoro-4-(2,2,3,3,5,5,6,6-octadeuteriothiomorpholin-4-yl)aniline;2,2,3,3,5,5,6,6-octadeuterio-4-(2,6-difluoro-4-nitrophenyl)thiomorpholine |
|---|---|
| PubChem CID | 159810906 |
| Molecular Formula | C20H22F4N4O2S2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 3,5-difluoro-4-(2,2,3,3,5,5,6,6-octadeuteriothiomorpholin-4-yl)aniline;2,2,3,3,5,5,6,6-octadeuterio-4-(2,6-difluoro-4-nitrophenyl)thiomorpholine |
| SMILES | [2H]C1([2H])SC([2H])([2H])C([2H])([2H])N(c2c(F)cc(N)cc2F)C1([2H])[2H].[2H]C1([2H])SC([2H])([2H])C([2H])([2H])N(c2c(F)cc([N+](=O)[O-])cc2F)C1([2H])[2H] |
| InChI | InChI=1S/C10H10F2N2O2S.C10H12F2N2S/c11-8-5-7(14(15)16)6-9(12)10(8)13-1-3-17-4-2-13;11-8-5-7(13)6-9(12)10(8)14-1-3-15-4-2-14/h5-6H,1-4H2;5-6H,1-4,13H2/i2*1D2,2D2,3D2,4D2 |
| InChIKey | NKZVLIVCWNZUEV-RLPUDOPDSA-N |
| XLogP | 4.53 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|