C18H29F2N3O2S — CID 166748432
4-(2,6-difluoro-4-nitrophenyl)thiomorpholine;N-ethyl-N-propan-2-ylpropan-2-amine (PubChem CID 166748432) has the molecular formula C18H29F2N3O2S and a molecular weight of 389.51 g/mol. Its IUPAC name is 4-(2,6-difluoro-4-nitrophenyl)thiomorpholine;N-ethyl-N-propan-2-ylpropan-2-amine.
| Compound Name | 4-(2,6-difluoro-4-nitrophenyl)thiomorpholine;N-ethyl-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 166748432 |
| Molecular Formula | C18H29F2N3O2S |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 4-(2,6-difluoro-4-nitrophenyl)thiomorpholine;N-ethyl-N-propan-2-ylpropan-2-amine |
| SMILES | CCN(C(C)C)C(C)C.O=[N+]([O-])c1cc(F)c(N2CCSCC2)c(F)c1 |
| InChI | InChI=1S/C10H10F2N2O2S.C8H19N/c11-8-5-7(14(15)16)6-9(12)10(8)13-1-3-17-4-2-13;1-6-9(7(2)3)8(4)5/h5-6H,1-4H2;7-8H,6H2,1-5H3 |
| InChIKey | HTRIJDOYHNKPHC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|