C14H19F2NS — CID 146324170
4-(4-tert-butyl-2,6-difluorophenyl)thiomorpholine (PubChem CID 146324170) has the molecular formula C14H19F2NS and a molecular weight of 271.38 g/mol. Its IUPAC name is 4-(4-tert-butyl-2,6-difluorophenyl)thiomorpholine.
| Compound Name | 4-(4-tert-butyl-2,6-difluorophenyl)thiomorpholine |
|---|---|
| PubChem CID | 146324170 |
| Molecular Formula | C14H19F2NS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-(4-tert-butyl-2,6-difluorophenyl)thiomorpholine |
| SMILES | CC(C)(C)c1cc(F)c(N2CCSCC2)c(F)c1 |
| InChI | InChI=1S/C14H19F2NS/c1-14(2,3)10-8-11(15)13(12(16)9-10)17-4-6-18-7-5-17/h8-9H,4-7H2,1-3H3 |
| InChIKey | KKUKIHFMDNRDIO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |