C13H18F2N4S — CID 142263698
(Z)-2-N-(3,5-difluoro-4-thiomorpholin-4-ylphenyl)prop-1-ene-1,2,3-triamine (PubChem CID 142263698) has the molecular formula C13H18F2N4S and a molecular weight of 300.38 g/mol. Its IUPAC name is (Z)-2-N-(3,5-difluoro-4-thiomorpholin-4-ylphenyl)prop-1-ene-1,2,3-triamine.
| Compound Name | (Z)-2-N-(3,5-difluoro-4-thiomorpholin-4-ylphenyl)prop-1-ene-1,2,3-triamine |
|---|---|
| PubChem CID | 142263698 |
| Molecular Formula | C13H18F2N4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (Z)-2-N-(3,5-difluoro-4-thiomorpholin-4-ylphenyl)prop-1-ene-1,2,3-triamine |
| SMILES | N/C=C(/CN)Nc1cc(F)c(N2CCSCC2)c(F)c1 |
| InChI | InChI=1S/C13H18F2N4S/c14-11-5-9(18-10(7-16)8-17)6-12(15)13(11)19-1-3-20-4-2-19/h5-7,18H,1-4,8,16-17H2/b10-7- |
| InChIKey | GZMBBFJGXAIMPU-YFHOEESVSA-N |
| XLogP | 1.69 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|