C16H21F2N3O4S — CID 170788153
(3,5-difluoro-4-thiomorpholin-4-ylphenyl)-[3-(methoxycarbonylamino)propyl]carbamic acid (PubChem CID 170788153) has the molecular formula C16H21F2N3O4S and a molecular weight of 389.42 g/mol. Its IUPAC name is (3,5-difluoro-4-thiomorpholin-4-ylphenyl)-[3-(methoxycarbonylamino)propyl]carbamic acid.
| Compound Name | (3,5-difluoro-4-thiomorpholin-4-ylphenyl)-[3-(methoxycarbonylamino)propyl]carbamic acid |
|---|---|
| PubChem CID | 170788153 |
| Molecular Formula | C16H21F2N3O4S |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (3,5-difluoro-4-thiomorpholin-4-ylphenyl)-[3-(methoxycarbonylamino)propyl]carbamic acid |
| SMILES | COC(=O)NCCCN(C(=O)O)c1cc(F)c(N2CCSCC2)c(F)c1 |
| InChI | InChI=1S/C16H21F2N3O4S/c1-25-15(22)19-3-2-4-21(16(23)24)11-9-12(17)14(13(18)10-11)20-5-7-26-8-6-20/h9-10H,2-8H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | INEAUOZIVBTKLE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|