C18H22FN3O5S — CID 156532172
methyl N-[[(3R,3aR)-9-fluoro-1-oxo-8-thiomorpholin-4-yl-3,3a,4,5-tetrahydro-[1,3]oxazolo[4,3-d][1,5]benzoxazepin-3-yl]methyl]carbamate (PubChem CID 156532172) has the molecular formula C18H22FN3O5S and a molecular weight of 411.46 g/mol. Its IUPAC name is methyl N-[[(3R,3aR)-9-fluoro-1-oxo-8-thiomorpholin-4-yl-3,3a,4,5-tetrahydro-[1,3]oxazolo[4,3-d][1,5]benzoxazepin-3-yl]methyl]carbamate.
| Compound Name | methyl N-[[(3R,3aR)-9-fluoro-1-oxo-8-thiomorpholin-4-yl-3,3a,4,5-tetrahydro-[1,3]oxazolo[4,3-d][1,5]benzoxazepin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 156532172 |
| Molecular Formula | C18H22FN3O5S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | methyl N-[[(3R,3aR)-9-fluoro-1-oxo-8-thiomorpholin-4-yl-3,3a,4,5-tetrahydro-[1,3]oxazolo[4,3-d][1,5]benzoxazepin-3-yl]methyl]carbamate |
| SMILES | COC(=O)NC[C@H]1OC(=O)N2c3cc(F)c(N4CCSCC4)cc3OCC[C@H]12 |
| InChI | InChI=1S/C18H22FN3O5S/c1-25-17(23)20-10-16-12-2-5-26-15-9-13(21-3-6-28-7-4-21)11(19)8-14(15)22(12)18(24)27-16/h8-9,12,16H,2-7,10H2,1H3,(H,20,23)/t12-,16-/m1/s1 |
| InChIKey | JGPFFBXPYSHMOV-MLGOLLRUSA-N |
| XLogP | 2.21 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|