C21H20ClN3O6S — CID 91826230
N-[[(3S,3aS)-1-oxo-8-(3-oxomorpholin-4-yl)-3,3a,4,5-tetrahydro-[1,3]oxazolo[4,3-d][1,5]benzoxazepin-3-yl]methyl]-5-chlorothiophene-2-carboxamide (PubChem CID 91826230) has the molecular formula C21H20ClN3O6S and a molecular weight of 477.93 g/mol. Its IUPAC name is N-[[(3S,3aS)-1-oxo-8-(3-oxomorpholin-4-yl)-3,3a,4,5-tetrahydro-[1,3]oxazolo[4,3-d][1,5]benzoxazepin-3-yl]methyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[[(3S,3aS)-1-oxo-8-(3-oxomorpholin-4-yl)-3,3a,4,5-tetrahydro-[1,3]oxazolo[4,3-d][1,5]benzoxazepin-3-yl]methyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 91826230 |
| Molecular Formula | C21H20ClN3O6S |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | N-[[(3S,3aS)-1-oxo-8-(3-oxomorpholin-4-yl)-3,3a,4,5-tetrahydro-[1,3]oxazolo[4,3-d][1,5]benzoxazepin-3-yl]methyl]-5-chlorothiophene-2-carboxamide |
| SMILES | O=C(NC[C@@H]1OC(=O)N2c3ccc(N4CCOCC4=O)cc3OCC[C@@H]12)c1ccc(Cl)s1 |
| InChI | InChI=1S/C21H20ClN3O6S/c22-18-4-3-17(32-18)20(27)23-10-16-14-5-7-30-15-9-12(24-6-8-29-11-19(24)26)1-2-13(15)25(14)21(28)31-16/h1-4,9,14,16H,5-8,10-11H2,(H,23,27)/t14-,16-/m0/s1 |
| InChIKey | HNBFGNRSNNHPMU-HOCLYGCPSA-N |
| XLogP | 2.67 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |