C20H19ClN4O5S — CID 118713029
N-[[(3S,3aS)-1-oxo-7-(3-oxomorpholin-4-yl)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinoxalin-3-yl]methyl]-5-chlorothiophene-2-carboxamide (PubChem CID 118713029) has the molecular formula C20H19ClN4O5S and a molecular weight of 462.92 g/mol. Its IUPAC name is N-[[(3S,3aS)-1-oxo-7-(3-oxomorpholin-4-yl)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinoxalin-3-yl]methyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[[(3S,3aS)-1-oxo-7-(3-oxomorpholin-4-yl)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinoxalin-3-yl]methyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 118713029 |
| Molecular Formula | C20H19ClN4O5S |
| Molecular Weight | 462.92 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[[(3S,3aS)-1-oxo-7-(3-oxomorpholin-4-yl)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinoxalin-3-yl]methyl]-5-chlorothiophene-2-carboxamide |
| SMILES | O=C(NC[C@@H]1OC(=O)N2c3ccc(N4CCOCC4=O)cc3NC[C@@H]12)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H19ClN4O5S/c21-17-4-3-16(31-17)19(27)23-9-15-14-8-22-12-7-11(24-5-6-29-10-18(24)26)1-2-13(12)25(14)20(28)30-15/h1-4,7,14-15,22H,5-6,8-10H2,(H,23,27)/t14-,15-/m0/s1 |
| InChIKey | OBFDBUDQIYACGH-GJZGRUSLSA-N |
| XLogP | 2.31 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.92 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |