C13H14F2N4S — CID 20810166
4-[2,6-difluoro-4-(4-methyltriazol-1-yl)phenyl]thiomorpholine (PubChem CID 20810166) has the molecular formula C13H14F2N4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-[2,6-difluoro-4-(4-methyltriazol-1-yl)phenyl]thiomorpholine.
| Compound Name | 4-[2,6-difluoro-4-(4-methyltriazol-1-yl)phenyl]thiomorpholine |
|---|---|
| PubChem CID | 20810166 |
| Molecular Formula | C13H14F2N4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-[2,6-difluoro-4-(4-methyltriazol-1-yl)phenyl]thiomorpholine |
| SMILES | Cc1cn(-c2cc(F)c(N3CCSCC3)c(F)c2)nn1 |
| InChI | InChI=1S/C13H14F2N4S/c1-9-8-19(17-16-9)10-6-11(14)13(12(15)7-10)18-2-4-20-5-3-18/h6-8H,2-5H2,1H3 |
| InChIKey | RHCACEMBWYQWRW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|