C15H17F2N5O2S — CID 87868299
N-[[1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl]-2-sulfanylacetamide (PubChem CID 87868299) has the molecular formula C15H17F2N5O2S and a molecular weight of 369.40 g/mol. Its IUPAC name is N-[[1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl]-2-sulfanylacetamide.
| Compound Name | N-[[1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 87868299 |
| Molecular Formula | C15H17F2N5O2S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[[1-(3,5-difluoro-4-morpholin-4-ylphenyl)triazol-4-yl]methyl]-2-sulfanylacetamide |
| SMILES | O=C(CS)NCc1cn(-c2cc(F)c(N3CCOCC3)c(F)c2)nn1 |
| InChI | InChI=1S/C15H17F2N5O2S/c16-12-5-11(6-13(17)15(12)21-1-3-24-4-2-21)22-8-10(19-20-22)7-18-14(23)9-25/h5-6,8,25H,1-4,7,9H2,(H,18,23) |
| InChIKey | KQNLCCWLXTUQQQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|