C17H20F2N6O3S — CID 11270246
O-methyl N-[[1-[3,5-difluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]triazol-4-yl]methyl]carbamothioate (PubChem CID 11270246) has the molecular formula C17H20F2N6O3S and a molecular weight of 426.45 g/mol. Its IUPAC name is O-methyl N-[[1-[3,5-difluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]triazol-4-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[1-[3,5-difluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]triazol-4-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 11270246 |
| Molecular Formula | C17H20F2N6O3S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | O-methyl N-[[1-[3,5-difluoro-4-[4-(2-hydroxyacetyl)piperazin-1-yl]phenyl]triazol-4-yl]methyl]carbamothioate |
| SMILES | COC(=S)NCc1cn(-c2cc(F)c(N3CCN(C(=O)CO)CC3)c(F)c2)nn1 |
| InChI | InChI=1S/C17H20F2N6O3S/c1-28-17(29)20-8-11-9-25(22-21-11)12-6-13(18)16(14(19)7-12)24-4-2-23(3-5-24)15(27)10-26/h6-7,9,26H,2-5,8,10H2,1H3,(H,20,29) |
| InChIKey | IUBNKMPZUFGUKW-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|