C18H20F2N6OS — CID 143096375
O-methyl N-[[1-[3,5-difluoro-4-(4-prop-2-ynylpiperazin-1-yl)phenyl]triazol-4-yl]methyl]carbamothioate (PubChem CID 143096375) has the molecular formula C18H20F2N6OS and a molecular weight of 406.46 g/mol. Its IUPAC name is O-methyl N-[[1-[3,5-difluoro-4-(4-prop-2-ynylpiperazin-1-yl)phenyl]triazol-4-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[1-[3,5-difluoro-4-(4-prop-2-ynylpiperazin-1-yl)phenyl]triazol-4-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 143096375 |
| Molecular Formula | C18H20F2N6OS |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | O-methyl N-[[1-[3,5-difluoro-4-(4-prop-2-ynylpiperazin-1-yl)phenyl]triazol-4-yl]methyl]carbamothioate |
| SMILES | C#CCN1CCN(c2c(F)cc(-n3cc(CNC(=S)OC)nn3)cc2F)CC1 |
| InChI | InChI=1S/C18H20F2N6OS/c1-3-4-24-5-7-25(8-6-24)17-15(19)9-14(10-16(17)20)26-12-13(22-23-26)11-21-18(28)27-2/h1,9-10,12H,4-8,11H2,2H3,(H,21,28) |
| InChIKey | QUHHWFQXBHDHNF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|