C18H25F2N7O4S — CID 143096377
O-methyl N-[[1-[4-[2-[[2-[[(2R)-2,3-dihydroxypropyl]amino]acetyl]amino]ethylamino]-3,5-difluorophenyl]triazol-4-yl]methyl]carbamothioate (PubChem CID 143096377) has the molecular formula C18H25F2N7O4S and a molecular weight of 473.51 g/mol. Its IUPAC name is O-methyl N-[[1-[4-[2-[[2-[[(2R)-2,3-dihydroxypropyl]amino]acetyl]amino]ethylamino]-3,5-difluorophenyl]triazol-4-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[1-[4-[2-[[2-[[(2R)-2,3-dihydroxypropyl]amino]acetyl]amino]ethylamino]-3,5-difluorophenyl]triazol-4-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 143096377 |
| Molecular Formula | C18H25F2N7O4S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | O-methyl N-[[1-[4-[2-[[2-[[(2R)-2,3-dihydroxypropyl]amino]acetyl]amino]ethylamino]-3,5-difluorophenyl]triazol-4-yl]methyl]carbamothioate |
| SMILES | COC(=S)NCc1cn(-c2cc(F)c(NCCNC(=O)CNC[C@@H](O)CO)c(F)c2)nn1 |
| InChI | InChI=1S/C18H25F2N7O4S/c1-31-18(32)24-6-11-9-27(26-25-11)12-4-14(19)17(15(20)5-12)23-3-2-22-16(30)8-21-7-13(29)10-28/h4-5,9,13,21,23,28-29H,2-3,6-8,10H2,1H3,(H,22,30)(H,24,32)/t13-/m1/s1 |
| InChIKey | JJRRHUYOGVMPLW-CYBMUJFWSA-N |
| XLogP | -0.96 |
| TPSA | 145.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|