C20H29FN7O4S+ — CID 143096440
[1-[3-fluoro-4-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethylamino]phenyl]triazol-4-yl]methyl-methoxycarbothioylazanium (PubChem CID 143096440) has the molecular formula C20H29FN7O4S+ and a molecular weight of 482.56 g/mol. Its IUPAC name is [1-[3-fluoro-4-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethylamino]phenyl]triazol-4-yl]methyl-methoxycarbothioylazanium.
| Compound Name | [1-[3-fluoro-4-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethylamino]phenyl]triazol-4-yl]methyl-methoxycarbothioylazanium |
|---|---|
| PubChem CID | 143096440 |
| Molecular Formula | C20H29FN7O4S+ |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | [1-[3-fluoro-4-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethylamino]phenyl]triazol-4-yl]methyl-methoxycarbothioylazanium |
| SMILES | COC(=S)[NH2+]Cc1cn(-c2ccc(NCCNC(=O)CNC(=O)OC(C)(C)C)c(F)c2)nn1 |
| InChI | InChI=1S/C20H28FN7O4S/c1-20(2,3)32-18(30)24-11-17(29)23-8-7-22-16-6-5-14(9-15(16)21)28-12-13(26-27-28)10-25-19(33)31-4/h5-6,9,12,22H,7-8,10-11H2,1-4H3,(H,23,29)(H,24,30)(H,25,33)/p+1 |
| InChIKey | SMGBFBZNOQCYFD-UHFFFAOYSA-O |
| XLogP | 0.45 |
| TPSA | 136.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|