C15H18FN5S2 — CID 20810185
N-[[1-(3-fluoro-4-thiomorpholin-4-ylphenyl)triazol-4-yl]methyl]ethanethioamide (PubChem CID 20810185) has the molecular formula C15H18FN5S2 and a molecular weight of 351.48 g/mol. Its IUPAC name is N-[[1-(3-fluoro-4-thiomorpholin-4-ylphenyl)triazol-4-yl]methyl]ethanethioamide.
| Compound Name | N-[[1-(3-fluoro-4-thiomorpholin-4-ylphenyl)triazol-4-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 20810185 |
| Molecular Formula | C15H18FN5S2 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-[[1-(3-fluoro-4-thiomorpholin-4-ylphenyl)triazol-4-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NCc1cn(-c2ccc(N3CCSCC3)c(F)c2)nn1 |
| InChI | InChI=1S/C15H18FN5S2/c1-11(22)17-9-12-10-21(19-18-12)13-2-3-15(14(16)8-13)20-4-6-23-7-5-20/h2-3,8,10H,4-7,9H2,1H3,(H,17,22) |
| InChIKey | HWTABYFYYNWTQC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|