C23H23F2N5S — CID 143096410
N-[[1-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3,5-difluorophenyl]triazol-4-yl]methyl]ethanethioamide (PubChem CID 143096410) has the molecular formula C23H23F2N5S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[[1-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3,5-difluorophenyl]triazol-4-yl]methyl]ethanethioamide.
| Compound Name | N-[[1-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3,5-difluorophenyl]triazol-4-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 143096410 |
| Molecular Formula | C23H23F2N5S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[[1-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3,5-difluorophenyl]triazol-4-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NCc1cn(-c2cc(F)c(C3=CCN(Cc4ccccc4)CC3)c(F)c2)nn1 |
| InChI | InChI=1S/C23H23F2N5S/c1-16(31)26-13-19-15-30(28-27-19)20-11-21(24)23(22(25)12-20)18-7-9-29(10-8-18)14-17-5-3-2-4-6-17/h2-7,11-12,15H,8-10,13-14H2,1H3,(H,26,31) |
| InChIKey | FSVJSXSDUQTLFJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|