C15H17F2N5O2S2 — CID 20810186
N-[[1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3,5-difluorophenyl]triazol-4-yl]methyl]ethanethioamide (PubChem CID 20810186) has the molecular formula C15H17F2N5O2S2 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[[1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3,5-difluorophenyl]triazol-4-yl]methyl]ethanethioamide.
| Compound Name | N-[[1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3,5-difluorophenyl]triazol-4-yl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 20810186 |
| Molecular Formula | C15H17F2N5O2S2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-[[1-[4-(1,1-dioxo-1,4-thiazinan-4-yl)-3,5-difluorophenyl]triazol-4-yl]methyl]ethanethioamide |
| SMILES | CC(=S)NCc1cn(-c2cc(F)c(N3CCS(=O)(=O)CC3)c(F)c2)nn1 |
| InChI | InChI=1S/C15H17F2N5O2S2/c1-10(25)18-8-11-9-22(20-19-11)12-6-13(16)15(14(17)7-12)21-2-4-26(23,24)5-3-21/h6-7,9H,2-5,8H2,1H3,(H,18,25) |
| InChIKey | RBCLZJDAMVKXMP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|