C15H18F2N6OS — CID 11314642
O-methyl N-[[1-(3,5-difluoro-4-piperazin-1-ylphenyl)triazol-4-yl]methyl]carbamothioate (PubChem CID 11314642) has the molecular formula C15H18F2N6OS and a molecular weight of 368.41 g/mol. Its IUPAC name is O-methyl N-[[1-(3,5-difluoro-4-piperazin-1-ylphenyl)triazol-4-yl]methyl]carbamothioate.
| Compound Name | O-methyl N-[[1-(3,5-difluoro-4-piperazin-1-ylphenyl)triazol-4-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 11314642 |
| Molecular Formula | C15H18F2N6OS |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | O-methyl N-[[1-(3,5-difluoro-4-piperazin-1-ylphenyl)triazol-4-yl]methyl]carbamothioate |
| SMILES | COC(=S)NCc1cn(-c2cc(F)c(N3CCNCC3)c(F)c2)nn1 |
| InChI | InChI=1S/C15H18F2N6OS/c1-24-15(25)19-8-10-9-23(21-20-10)11-6-12(16)14(13(17)7-11)22-4-2-18-3-5-22/h6-7,9,18H,2-5,8H2,1H3,(H,19,25) |
| InChIKey | USQJAUGEILAUBU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|