C18H24F2N7O5PS — CID 143096087
O-amino N-[[1-[4-[4-(2-dimethoxyphosphorylacetyl)piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]carbamothioate (PubChem CID 143096087) has the molecular formula C18H24F2N7O5PS and a molecular weight of 519.47 g/mol. Its IUPAC name is O-amino N-[[1-[4-[4-(2-dimethoxyphosphorylacetyl)piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]carbamothioate.
| Compound Name | O-amino N-[[1-[4-[4-(2-dimethoxyphosphorylacetyl)piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]carbamothioate |
|---|---|
| PubChem CID | 143096087 |
| Molecular Formula | C18H24F2N7O5PS |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | O-amino N-[[1-[4-[4-(2-dimethoxyphosphorylacetyl)piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]carbamothioate |
| SMILES | COP(=O)(CC(=O)N1CCN(c2c(F)cc(-n3cc(CNC(=S)ON)nn3)cc2F)CC1)OC |
| InChI | InChI=1S/C18H24F2N7O5PS/c1-30-33(29,31-2)11-16(28)25-3-5-26(6-4-25)17-14(19)7-13(8-15(17)20)27-10-12(23-24-27)9-22-18(34)32-21/h7-8,10H,3-6,9,11,21H2,1-2H3,(H,22,34) |
| InChIKey | TXGHUZBOWWWXEC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|