C24H22F2N6O2S — CID 143096037
N-[[1-[4-[4-(4-ethenylbenzoyl)piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]-2-oxoethanethioamide (PubChem CID 143096037) has the molecular formula C24H22F2N6O2S and a molecular weight of 496.54 g/mol. Its IUPAC name is N-[[1-[4-[4-(4-ethenylbenzoyl)piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]-2-oxoethanethioamide.
| Compound Name | N-[[1-[4-[4-(4-ethenylbenzoyl)piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]-2-oxoethanethioamide |
|---|---|
| PubChem CID | 143096037 |
| Molecular Formula | C24H22F2N6O2S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-[[1-[4-[4-(4-ethenylbenzoyl)piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]-2-oxoethanethioamide |
| SMILES | C=Cc1ccc(C(=O)N2CCN(c3c(F)cc(-n4cc(CNC(=S)C=O)nn4)cc3F)CC2)cc1 |
| InChI | InChI=1S/C24H22F2N6O2S/c1-2-16-3-5-17(6-4-16)24(34)31-9-7-30(8-10-31)23-20(25)11-19(12-21(23)26)32-14-18(28-29-32)13-27-22(35)15-33/h2-6,11-12,14-15H,1,7-10,13H2,(H,27,35) |
| InChIKey | VNWJUABZDMAGAP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|