C18H22F2N6O4 — CID 143096388
N-[[1-[4-[4-[(2R)-2,3-dihydroxypropanoyl]piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]acetamide (PubChem CID 143096388) has the molecular formula C18H22F2N6O4 and a molecular weight of 424.41 g/mol. Its IUPAC name is N-[[1-[4-[4-[(2R)-2,3-dihydroxypropanoyl]piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]acetamide.
| Compound Name | N-[[1-[4-[4-[(2R)-2,3-dihydroxypropanoyl]piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 143096388 |
| Molecular Formula | C18H22F2N6O4 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[[1-[4-[4-[(2R)-2,3-dihydroxypropanoyl]piperazin-1-yl]-3,5-difluorophenyl]triazol-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1cn(-c2cc(F)c(N3CCN(C(=O)[C@H](O)CO)CC3)c(F)c2)nn1 |
| InChI | InChI=1S/C18H22F2N6O4/c1-11(28)21-8-12-9-26(23-22-12)13-6-14(19)17(15(20)7-13)24-2-4-25(5-3-24)18(30)16(29)10-27/h6-7,9,16,27,29H,2-5,8,10H2,1H3,(H,21,28)/t16-/m1/s1 |
| InChIKey | JFHDFJLKXOEHJD-MRXNPFEDSA-N |
| XLogP | -0.82 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|